Pigment Red 179 structure
|
Common Name | Pigment Red 179 | ||
|---|---|---|---|---|
| CAS Number | 5521-31-3 | Molecular Weight | 418.400 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 694.8±28.0 °C at 760 mmHg | |
| Molecular Formula | C26H14N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 341.1±16.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N, N′-Dimethyl-3,4,9,10-perylenedicarboximide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 694.8±28.0 °C at 760 mmHg |
| Molecular Formula | C26H14N2O4 |
| Molecular Weight | 418.400 |
| Flash Point | 341.1±16.4 °C |
| Exact Mass | 418.095367 |
| PSA | 78.14000 |
| LogP | 1.87 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.905 |
| InChIKey | PJQYNUFEEZFYIS-UHFFFAOYSA-N |
| SMILES | CN1C(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C1=O)c64)C(=O)N(C)C5=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| RTECS | CB1590000 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
|
Understanding ground- and excited-state properties of perylene tetracarboxylic acid bisimide crystals by means of quantum chemical computations.
J. Am. Chem. Soc. 131 , 15660-15668, (2009) Quantum chemical protocols explaining the crystal structures and the visible light absorption properties of 3,4:9,10-perylene tetracarboxylic acid bisimide (PBI) derivates are proposed. Dispersion-cor... |
| 2,9-Dimethylisoquinolino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone |
| Isoquino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone, 2,9-dimethyl- |
| 2,9-dimethylisoquino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone |
| Anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone, 2,9-dimethyl- |
| Pigment Red 179 |