3-Phosphorincarbonitrile,4-amino-1,2,5,6-tetrahydro-1-phenyl- structure
|
Common Name | 3-Phosphorincarbonitrile,4-amino-1,2,5,6-tetrahydro-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 23848-09-1 | Molecular Weight | 216.21900 | |
| Density | N/A | Boiling Point | 460.3ºC at 760mmHg | |
| Molecular Formula | C12H13N2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.2ºC | |
| Name | 4-amino-1-phenyl-3,6-dihydro-2H-phosphinine-5-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 460.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H13N2P |
| Molecular Weight | 216.21900 |
| Flash Point | 232.2ºC |
| Exact Mass | 216.08200 |
| PSA | 63.40000 |
| LogP | 2.63418 |
| Vapour Pressure | 1.17E-08mmHg at 25°C |
| InChIKey | ITLIZVVJVNRIIR-UHFFFAOYSA-N |
| SMILES | N#CC1=C(N)CCP(c2ccccc2)C1 |
| HS Code | 2934999090 |
|---|
|
~%
3-Phosphorincar... CAS#:23848-09-1 |
| Literature: Welcher,R.P. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 4437 - 4438 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Amino-1-phenyl-1,2,5,6-tetrahydro-phosphorin-3-carbonitril |
| 4-Amino-3-cyan-1-phenyl-1,2,5,6-tetrahydro-phosphorin |
| 4-amino-1-phenyl-1,2,5,6-tetrahydrophosphinine-3-carbonitrile |
| 1-Phenyl-3-cyan-4-amino-phosphorinen |
| 4-Amino-1,2,5,6-tetrahydro-1-phenylphosphorin-3-carbonitril |