4-phenyl-8,10-diaza-4-phosphabicyclo[4.4.0]deca-8,11-diene-7-thione structure
|
Common Name | 4-phenyl-8,10-diaza-4-phosphabicyclo[4.4.0]deca-8,11-diene-7-thione | ||
|---|---|---|---|---|
| CAS Number | 38626-64-1 | Molecular Weight | 260.29400 | |
| Density | N/A | Boiling Point | 433.7ºC at 760mmHg | |
| Molecular Formula | C13H13N2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.1ºC | |
| Name | 6-phenyl-1,5,7,8-tetrahydrophosphinino[4,3-d]pyrimidine-4-thione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 433.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H13N2PS |
| Molecular Weight | 260.29400 |
| Flash Point | 216.1ºC |
| Exact Mass | 260.05400 |
| PSA | 74.36000 |
| LogP | 3.00270 |
| InChIKey | GACULOQWUYNVCE-UHFFFAOYSA-N |
| SMILES | S=c1nc[nH]c2c1CP(c1ccccc1)CC2 |
|
~%
4-phenyl-8,10-d... CAS#:38626-64-1 |
| Literature: Snider; Berlin The Journal of organic chemistry, 1973 , vol. 38, # 9 p. 1657 - 1662 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| S03-0378 |
| 6-phenyl-5,6,7,8-tetrahydrophosphinino[4,3-d]pyrimidine-4-thiol |
| 6-phenyl-5,6,7,8-tetrahydro-3H-phosphinino[4,3-d]pyrimidine-4-thione |
| 6-phenyl-7,8-dihydro-5H-phosphinino[3,4-e]pyrimidine-4-thiol |