4,4'-Ethylenebis(2,6-morpholinedione) structure
|
Common Name | 4,4'-Ethylenebis(2,6-morpholinedione) | ||
|---|---|---|---|---|
| CAS Number | 23911-25-3 | Molecular Weight | 256.212 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 489.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H12N2O6 | Melting Point | 190ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 249.8±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[2-(2,6-dioxomorpholin-4-yl)ethyl]morpholine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.5±45.0 °C at 760 mmHg |
| Melting Point | 190ºC (dec.)(lit.) |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.212 |
| Flash Point | 249.8±28.7 °C |
| Exact Mass | 256.069550 |
| PSA | 93.22000 |
| LogP | -2.48 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | POLIXZIAIMAECK-UHFFFAOYSA-N |
| SMILES | O=C1CN(CCN2CC(=O)OC(=O)C2)CC(=O)O1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3.0 |
| HS Code | 2934999090 |
|
~93%
4,4'-Ethylenebi... CAS#:23911-25-3 |
| Literature: Capretta; Maharajh; Bell Carbohydrate Research, 1995 , vol. 267, # 1 p. 49 - 63 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EDTA-bisanhydride |
| 4,4'-ethane-1,2-diyldimorpholine-2,6-dione |
| EDTA-dianhydride |
| 2,6-Morpholinedione,4,4'-(1,2-ethanediyl)bis |
| 4,4'-(ethane-1,2-diyl)bis(morpholine-2,6-dione) |
| 4,4'-(1,2-Ethanediyl)di(2,6-morpholinedione) |
| ETHYLENEDIAMINETETRAACETIC DIANHYDRIDE |
| EDTA Dianhydride |
| MFCD00074963 |
| 4,4'-Ethylenebis(2,6-morpholinedione) |
| 2,6-Morpholinedione, 4,4'-(1,2-ethanediyl)bis- |