DiethylenetriaMinepentaacetic Dianhydride structure
|
Common Name | DiethylenetriaMinepentaacetic Dianhydride | ||
|---|---|---|---|---|
| CAS Number | 23911-26-4 | Molecular Weight | 357.316 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 656.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C14H19N3O8 | Melting Point | 182-184 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 350.6±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 656.2±55.0 °C at 760 mmHg |
| Melting Point | 182-184 °C(lit.) |
| Molecular Formula | C14H19N3O8 |
| Molecular Weight | 357.316 |
| Flash Point | 350.6±31.5 °C |
| Exact Mass | 357.117218 |
| PSA | 133.76000 |
| LogP | -2.08 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | RAZLJUXJEOEYAM-UHFFFAOYSA-N |
| SMILES | O=C(O)CN(CCN1CC(=O)OC(=O)C1)CCN1CC(=O)OC(=O)C1 |
| Storage condition | −20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
|
~95%
DiethylenetriaM... CAS#:23911-26-4 |
| Literature: THE UNIVERSITY OF NORTH CAROLINA AT CHAPEL HILL; JAY, Michael; MUMPER, Russell; HUCKLE, James; SADGROVE, Matthew Patent: WO2014/82046 A1, 2014 ; Location in patent: Page/Page column 21 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Self-assembling bubble carriers for oral protein delivery.
Biomaterials 64 , 115-24, (2015) Successful oral delivery of therapeutic proteins such as insulin can greatly improve the quality of life of patients. This study develops a bubble carrier system by loading diethylene triamine pentaac... |
|
|
A Hyaluronic Acid-Conjugated Gadolinium Hepatocyte-Specific T1 Contrast Agent for Liver Magnetic Resonance Imaging.
Mol. Imaging Biol. 17 , 497-503, (2015) In this study, we synthesized hyaluronic acid-conjugated gadolinium (HA-diethylene triamine pentaacetic acid (DTPA)-Gd) and evaluated as hepatocyte-specific magnetic resonance imaging (MRI) contrast a... |
|
|
A comparison of the cyclic anhydride and mixed anhydride methods for 111In-DTPA chelation to monoclonal antibodies.
Nuklearmedizin. 23(4) , 193-5, (1984) The cyclic anhydride (CA) and the mixed anhydride (MA) of DTPA were synthesized and used to chelate 111In to an antimelanoma monoclonal antibody. The CA and MA methods showed mean labeling efficiencie... |
| N,N-Bis[2-(2,6-dioxomorpholino)ethyl]glycine |
| N,N-Bis[2-(2,6-dioxo-4-morpholinyl)ethyl]glycine |
| Dtpa cyclic anhydride |
| diethylenetriaminopentaacetic acid bis-anhydride |
| Glycine, N,N-bis[2-(2,6-dioxo-4-morpholinyl)ethyl]- |
| DiethylenetriaMinepentaacetic Dianhydride |
| DTPA anhydride |
| MFCD00010697 |
| DTPA Eaou |
| Cdtpaa |
| Cyclic dtpa anhydride |
| Diethylenetriaminepentaacetic acid dianhydride (DTPA) |
| diethylenetriamine-N,N',N',N'',N''-pentaacetic acid bisanhydride |
| diethylenetriamine-pentaacetic acid dianhydride |
| N,N-Bis[2-(2,6-dioxomorpholin-4-yl)ethyl]glycine |