Potassium perfluorooctanoate structure
|
Common Name | Potassium perfluorooctanoate | ||
|---|---|---|---|---|
| CAS Number | 2395-00-8 | Molecular Weight | 452.15900 | |
| Density | 1.745g/cm3 | Boiling Point | 188ºC at 760mmHg | |
| Molecular Formula | C8F15KO2 | Melting Point | 52-54ºC | |
| MSDS | N/A | Flash Point | 62.1ºC | |
| Name | potassium perfluorooctanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.745g/cm3 |
|---|---|
| Boiling Point | 188ºC at 760mmHg |
| Melting Point | 52-54ºC |
| Molecular Formula | C8F15KO2 |
| Molecular Weight | 452.15900 |
| Flash Point | 62.1ºC |
| Exact Mass | 451.93000 |
| PSA | 40.13000 |
| LogP | 3.11040 |
| Vapour Pressure | 0.274mmHg at 25°C |
| InChIKey | WPDDXKNWUVLZMQ-UHFFFAOYSA-M |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2915900090 |
|
~77%
Potassium perfl... CAS#:2395-00-8 |
| Literature: Langanis, E. D.; Chenard, B. L. Tetrahedron Letters, 1984 , vol. 25, # 51 p. 5831 - 5834 |
|
~%
Potassium perfl... CAS#:2395-00-8 |
| Literature: DAIKIN INDUSTRIES, LTD Patent: JP2005/350377 A, 2005 ; Location in patent: Page/Page column 10 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Pentadecafluor-octansaeure,Kalium-pentadecafluoroctanoat |
| pentadecafluoro-octanoic acid,potassium pentadecafluorooctanoate |
| perfluorooctanoate |
| Potassium2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| POTASSIUMPERFLUOROCTANOATE |
| Potassiumperfluorooctanoate |
| potassium salt of perfluorooctanoic acid |