glochidonol structure
|
Common Name | glochidonol | ||
|---|---|---|---|---|
| CAS Number | 23963-54-4 | Molecular Weight | 440.701 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 516.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.2±22.7 °C | |
Use of glochidonolGlochidonol is a triterpene ketol that can be isolated from the stems of Glochidion wrightii Benth (Euphorbiaceae)[1]. |
| Name | (1β)-1-Hydroxylup-20(29)-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Glochidonol is a triterpene ketol that can be isolated from the stems of Glochidion wrightii Benth (Euphorbiaceae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 516.0±50.0 °C at 760 mmHg |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.701 |
| Flash Point | 218.2±22.7 °C |
| Exact Mass | 440.365417 |
| PSA | 37.30000 |
| LogP | 8.83 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | POKGESLRCWHPFR-GEWRCSBCSA-N |
| SMILES | C=C(C)C1CCC2(C)CCC3(C)C(CCC4C5(C)C(O)CC(=O)C(C)(C)C5CCC43C)C12 |
| Hazard Codes | Xi |
|---|
| 7,3',4'-Trihydroxy-5-methoxy-5'-prenylisoflavone |
| (1β)-1-Hydroxylup-20(29)-en-3-one |
| glochidonol |
| Glisoflavone |