4-chloro-1-methyl-1H-indole-2-carboxylic acid structure
|
Common Name | 4-chloro-1-methyl-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 23967-44-4 | Molecular Weight | 209.62900 | |
| Density | 1.39g/cm3 | Boiling Point | 420.6ºC at 760 mmHg | |
| Molecular Formula | C10H8ClNO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 208.2ºC | |
| Name | 4-chloro-1-methylindole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 420.6ºC at 760 mmHg |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.62900 |
| Flash Point | 208.2ºC |
| Exact Mass | 209.02400 |
| PSA | 42.23000 |
| LogP | 2.52990 |
| Vapour Pressure | 7.94E-08mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | VGCZPBOQBLXWRG-UHFFFAOYSA-N |
| SMILES | Cn1c(C(=O)O)cc2c(Cl)cccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| BB_SC-9315 |
| 4-chloro-1-methyl-1H-indole-2-carboxylic acid |
| 4-Chlor-1-methylindol-2-carbonsaeure |