6-chloro-1-methyl-1H-indole-2-carboxylic acid(SALTDATA: FREE) structure
|
Common Name | 6-chloro-1-methyl-1H-indole-2-carboxylic acid(SALTDATA: FREE) | ||
|---|---|---|---|---|
| CAS Number | 680569-83-9 | Molecular Weight | 209.62900 | |
| Density | 1.39g/cm3 | Boiling Point | 420.6ºC at 760 mmHg | |
| Molecular Formula | C10H8ClNO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 208.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-chloro-1-methylindole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 420.6ºC at 760 mmHg |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.62900 |
| Flash Point | 208.2ºC |
| Exact Mass | 209.02400 |
| PSA | 42.23000 |
| LogP | 2.52990 |
| Index of Refraction | 1.631 |
| InChIKey | BMHTUBVXMTYFAS-UHFFFAOYSA-N |
| SMILES | Cn1c(C(=O)O)cc2ccc(Cl)cc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-1-methyl-1H-indole-2-carboxylic acid |
| BB_SC-8789 |