2-(dibutylamino)ethyl 2-methylprop-2-enoate
Modify Date: 2025-08-21 21:33:02
2-(dibutylamino)ethyl 2-methylprop-2-enoate structure
|
Common Name | 2-(dibutylamino)ethyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 2397-75-3 | Molecular Weight | 241.37000 | |
| Density | 0.909g/cm3 | Boiling Point | 311.5ºC at 760mmHg | |
| Molecular Formula | C14H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.2ºC | |
| Name | 2-(dibutylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.909g/cm3 |
|---|---|
| Boiling Point | 311.5ºC at 760mmHg |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37000 |
| Flash Point | 95.2ºC |
| Exact Mass | 241.20400 |
| PSA | 29.54000 |
| LogP | 3.00790 |
| Vapour Pressure | 0.00056mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | UATUCIKYJLUTBD-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCN(CCCC)CCCC |
| HS Code | 2922199090 |
|---|
|
~%
2-(dibutylamino... CAS#:2397-75-3 |
| Literature: 3M Innovative Properties Company Patent: US2012/252980 A1, 2012 ; Location in patent: Page/Page column 8 ; |
|
~53%
2-(dibutylamino... CAS#:2397-75-3 |
| Literature: Zhou, Kejin; Wang, Yiguang; Huang, Xiaonan; Luby-Phelps, Katherine; Sumer, Baran D.; Gao, Jinming Angewandte Chemie - International Edition, 2011 , vol. 50, # 27 p. 6109 - 6114 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Propenoic acid,2-methyl-,2-(dibutylamino)ethyl ester |
| N,N-dibutylaminoethyl methacrylate |
| methacrylic acid-(2-dibutylamino-ethyl ester) |
| 2-(di-n-butylamino)ethyl methacrylate |
| 2-(dibutylamino)ethyl methacrylate |
| EINECS 219-262-4 |
| Methacrylsaeure-(2-dibutylamino-aethylester) |