5,11-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one structure
|
Common Name | 5,11-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one | ||
|---|---|---|---|---|
| CAS Number | 24000-48-4 | Molecular Weight | 239.27300 | |
| Density | 1.223g/cm3 | Boiling Point | 428.9ºC at 760 mmHg | |
| Molecular Formula | C14H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
| Name | 5,11-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.223g/cm3 |
|---|---|
| Boiling Point | 428.9ºC at 760 mmHg |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.27300 |
| Flash Point | 213.2ºC |
| Exact Mass | 239.10600 |
| PSA | 39.82000 |
| LogP | 1.98740 |
| Vapour Pressure | 1.47E-07mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | MLWIUGGSNLPGMK-UHFFFAOYSA-N |
| SMILES | CN1C(=O)c2ccccc2N(C)c2ncccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N5,N11-Dimethyl-5,11-dihydro-6H-pyrido(2,3-b)(1,4)benzodiazepin-6-one |
| 5,11-dimethyl-5,11-dihydro-benzo[e]pyrido[3,2-b][1,4]diazepin-6-one |