5,11-diethylpyrido[2,3-b][1,4]benzodiazepin-6-one structure
|
Common Name | 5,11-diethylpyrido[2,3-b][1,4]benzodiazepin-6-one | ||
|---|---|---|---|---|
| CAS Number | 24000-53-1 | Molecular Weight | 267.32600 | |
| Density | 1.158g/cm3 | Boiling Point | 448.6ºC at 760 mmHg | |
| Molecular Formula | C16H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | 5,11-diethylpyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 448.6ºC at 760 mmHg |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.32600 |
| Flash Point | 225.1ºC |
| Exact Mass | 267.13700 |
| PSA | 39.82000 |
| LogP | 2.95320 |
| Vapour Pressure | 3.07E-08mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | KTFNVVFLPNSVAX-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)c2ccccc2N(CC)c2ncccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,11-diethyl-5,11-dihydro-benzo[e]pyrido[3,2-b][1,4]diazepin-6-one |
| N5,N11-Diethyl-5,11-dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| Pyridobenzodiazepinone deriv. 117 |