3-Methoxy-6-methyl-2-nitropyridine structure
|
Common Name | 3-Methoxy-6-methyl-2-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 24015-98-3 | Molecular Weight | 168.150 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 319.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.0±26.5 °C | |
| Name | 3-methoxy-6-methyl-2-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 319.4±37.0 °C at 760 mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.150 |
| Flash Point | 147.0±26.5 °C |
| Exact Mass | 168.053497 |
| PSA | 67.94000 |
| LogP | 1.20 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | YEEJSIYKPVLUKN-UHFFFAOYSA-N |
| SMILES | COc1ccc(C)nc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~99%
3-Methoxy-6-met... CAS#:24015-98-3 |
| Literature: Wyeth Patent: US2006/173049 A1, 2006 ; Location in patent: Page/Page column 23-24 ; US 20060173049 A1 |
|
~10%
3-Methoxy-6-met... CAS#:24015-98-3 |
| Literature: Boehringer Ingelheim (Canada) Ltd. Patent: US2003/236251 A1, 2003 ; Location in patent: Page 23 ; |
|
~%
3-Methoxy-6-met... CAS#:24015-98-3 |
| Literature: Heterocycles, , vol. 38, # 3 p. 529 - 540 |
|
~%
3-Methoxy-6-met... CAS#:24015-98-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 19, # 23 p. 6507 - 6514 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 3-methoxy-6-methyl-2-nitro- |
| 6-Methyl-3-(methyloxy)-2-nitropyridine |
| 2-methyl-5-methoxy-6-nitropyridine |
| 3-methoxy-6-methyl-2-nitro-pyridine |
| 3-Methoxy-6-methyl-2-nitro-pyridin |
| 3-Methoxy-6-methyl-2-nitropyridine |
| 3-Methoxy-2-nitro-6-picoline |