Methyl 5-methoxy-6-nitro-2-pyridinecarboxylate structure
|
Common Name | Methyl 5-methoxy-6-nitro-2-pyridinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 390816-44-1 | Molecular Weight | 212.160 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 380.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.2±26.5 °C | |
| Name | Methyl 5-methoxy-6-nitropicolinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 380.9±37.0 °C at 760 mmHg |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.160 |
| Flash Point | 184.2±26.5 °C |
| Exact Mass | 212.043320 |
| PSA | 94.24000 |
| LogP | 0.56 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | OCQAYEZVBSVDLF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC)c([N+](=O)[O-])n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~%
Methyl 5-methox... CAS#:390816-44-1 |
| Literature: WO2008/125111 A1, ; Page/Page column 23-24 ; |
|
~%
Methyl 5-methox... CAS#:390816-44-1 |
| Literature: US2002/65418 A1, ; |
|
~%
Methyl 5-methox... CAS#:390816-44-1 |
| Literature: US2003/236251 A1, ; Page 23 ; |
|
~%
Methyl 5-methox... CAS#:390816-44-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 19, # 23 p. 6507 - 6514 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 5-methoxy-6-nitropyridine-2-carboxylate |
| 2-Pyridinecarboxylic acid, 5-methoxy-6-nitro-, methyl ester |
| Methyl 5-methoxy-6-nitro-2-pyridinecarboxylate |