Triazophos structure
|
Common Name | Triazophos | ||
|---|---|---|---|---|
| CAS Number | 24017-47-8 | Molecular Weight | 313.313 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 417.6±28.0 °C at 760 mmHg | |
| Molecular Formula | C12H16N3O3PS | Melting Point | 0-5°C | |
| MSDS | Chinese USA | Flash Point | 206.3±24.0 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | triazophos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 417.6±28.0 °C at 760 mmHg |
| Melting Point | 0-5°C |
| Molecular Formula | C12H16N3O3PS |
| Molecular Weight | 313.313 |
| Flash Point | 206.3±24.0 °C |
| Exact Mass | 313.065002 |
| PSA | 100.30000 |
| LogP | 3.99 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | AMFGTOFWMRQMEM-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1ncn(-c2ccccc2)n1 |
| Water Solubility | 30-40 mg/L at 20 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H330-H410 |
| Precautionary Statements | P260-P273-P284-P301 + P310 + P330-P304 + P340 + P310-P403 + P233 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T:Toxic |
| Risk Phrases | R21;R23/25;R50/53 |
| Safety Phrases | 1/2-36/37-45-60-61 |
| RIDADR | 3018 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 29280090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990011 |
|---|---|
| Summary | 2933990011 o,o-diethyl o-quinoxalin-2-yl phosphorothioate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
Fast agitated directly suspended droplet microextraction technique for the rapid analysis of eighteen organophosphorus pesticides in human blood.
J. Chromatogr. A. 1377 , 27-34, (2015) A new sample preparation technique named as fast agitated directly suspended droplet microextraction (FA-DSDME) was proposed as an improved version of directly suspended droplet microextraction (DSDME... |
|
|
Effect of acute exposure of triazophos on oxidative stress and histopathological alterations in liver, kidney and brain of Wistar rats.
Indian J. Exp. Biol. 52(8) , 814-9, (2014) Acute dose of organophosphorus pesticide Triazophos (O,O-diethyl O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate; Tz) administered orally affects oxidative stress parameters and the histo-architectu... |
|
|
Roseomonas rhizosphaerae sp. nov., a triazophos-degrading bacterium isolated from soil.
Int. J. Syst. Evol. Microbiol. 64(Pt 4) , 1127-33, (2014) A novel aerobic, non-spore-forming, non-motile, catalase- and oxidase-positive, Gram-stain-negative, coccoid to short-rod-shaped bacterial strain, designated YW11(T), was isolated from soil under long... |
| TRELKA |
| O,O-diethyl O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate |
| O,O-Diethyl-O-(1-phenyl-1H-1,2,4-triazol-3-yl)thiophosphat |
| ABLE |
| Thiophosphate de O,O-diéthyle et de O-(1-phényl-1H-1,2,4-triazol-3-yle) |
| FULSTOP |
| SPARK |
| Triazophos |
| MFCD00055327 |
| O,O-diethyl O-1-phenyl-1H-imidazol-4-yl phosphorothioate |
| Phosphorothioic acid, O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) ester |
| EINECS 245-986-5 |
| O,O-Diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) phosphorothioate |
| MSS CMPP |
| HOE 2960 |
| TRY |
| Triazophos PESTANAL(R),analytical standard |
| TRIUMPH |