N-(3-aminopropyl)-2-nitrobenzenesulfonamide structure
|
Common Name | N-(3-aminopropyl)-2-nitrobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 240423-09-0 | Molecular Weight | 259.28200 | |
| Density | 1.375g/cm3 | Boiling Point | 448.997ºC at 760 mmHg | |
| Molecular Formula | C9H13N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.346ºC | |
| Name | N-(3-aminopropyl)-2-nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 448.997ºC at 760 mmHg |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.28200 |
| Flash Point | 225.346ºC |
| Exact Mass | 259.06300 |
| PSA | 126.39000 |
| LogP | 2.91710 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | MZMDBLLVFCKLRT-UHFFFAOYSA-N |
| SMILES | NCCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2935009090 |
|---|
|
~84%
N-(3-aminopropy... CAS#:240423-09-0 |
| Literature: Anderson, Marc O.; Sherrill, John; Madrid, Peter B.; Liou, Ally P.; Weisman, Jennifer L.; DeRisi, Joseph L.; Guy, R. Kiplin Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 2 p. 334 - 343 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| mono-2-nitrobenzenesulfonamide-1,3-diaminopropane |
| AmbotzNNN1001 |