o-Nitrophenylsulfonyl chloride structure
|
Common Name | o-Nitrophenylsulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1694-92-4 | Molecular Weight | 221.618 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 350.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C6H4ClNO4S | Melting Point | 63-67 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 165.8±23.2 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2-Nitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 350.6±25.0 °C at 760 mmHg |
| Melting Point | 63-67 °C(lit.) |
| Molecular Formula | C6H4ClNO4S |
| Molecular Weight | 221.618 |
| Flash Point | 165.8±23.2 °C |
| Exact Mass | 220.954956 |
| PSA | 88.34000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | WPHUUIODWRNJLO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Cl |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~%
o-Nitrophenylsu... CAS#:1694-92-4 |
| Literature: Helvetica Chimica Acta, , vol. 12, p. 663 Org.Synth.Coll.Vol.II<1943>,471 Organic Syntheses, , vol. 15, p. 55 Organic Syntheses, , vol. Coll. Vol. II, p. 472 |
|
~%
o-Nitrophenylsu... CAS#:1694-92-4 |
| Literature: Chemische Berichte, , vol. 90, p. 841,843 Farmaco, Edizione Scientifica, , vol. 14, p. 751,761 |
|
~%
o-Nitrophenylsu... CAS#:1694-92-4 |
| Literature: Helvetica Chimica Acta, , vol. 12, p. 663 |
|
~%
o-Nitrophenylsu... CAS#:1694-92-4 |
|
Literature: Diss. |
|
~%
Detail
|
|
Literature: Diss. |
|
~%
o-Nitrophenylsu... CAS#:1694-92-4
Detail
|
| Literature: Journal of the Chemical Society, , p. 887,893 |
|
~78%
o-Nitrophenylsu... CAS#:1694-92-4 |
| Literature: US6365780 B1, ; Page column 6 ; |
|
~%
o-Nitrophenylsu... CAS#:1694-92-4 |
| Literature: Helvetica Chimica Acta, , vol. 12, p. 663 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-nitrosulfonyl chloride |
| o-Nitrobenzenesulfonyl chloride |
| Benzenesulfonyl chloride, o-nitro- |
| 2-Nitrobenzenesulfonyl chloride |
| Benzenesulfonyl chloride,o-nitro |
| O-NITROBENZENESULPHONYL CHLORIDE |
| o-Nitrobenzene sufonyl chloride |
| 2-Nosyl chloride |
| Benzenesulfonyl chloride, 2-nitro- |
| o-Nitrophenylsulfonyl chloride |
| o-nitrobenzensulfonyl chloride |
| Benzenesulfonyl chloride,2-nitro |
| 2-Nitrobenzenesulfonylchloride |
| MFCD00007430 |
| EINECS 216-907-1 |
| 2-Nitrobenzene-1-sulfonyl chloride |
| 2-Nitrobenzene sulfonyl chloride |