2-[(p-Fluorobenzylidene)amino]-4-phenylthiazole structure
|
Common Name | 2-[(p-Fluorobenzylidene)amino]-4-phenylthiazole | ||
|---|---|---|---|---|
| CAS Number | 24050-99-5 | Molecular Weight | 282.33500 | |
| Density | 1.22g/cm3 | Boiling Point | 445.435ºC at 760 mmHg | |
| Molecular Formula | C16H11FN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.192ºC | |
| Name | (E)-1-(4-fluorophenyl)-N-(4-phenyl-1,3-thiazol-2-yl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 445.435ºC at 760 mmHg |
| Molecular Formula | C16H11FN2S |
| Molecular Weight | 282.33500 |
| Flash Point | 223.192ºC |
| Exact Mass | 282.06300 |
| PSA | 53.49000 |
| LogP | 4.69980 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | UVXFNFYOQFXODC-VCHYOVAHSA-N |
| SMILES | Fc1ccc(C=Nc2nc(-c3ccccc3)cs2)cc1 |
| HS Code | 2934100090 |
|---|
|
~%
2-[(p-Fluoroben... CAS#:24050-99-5 |
| Literature: Bessin,P. et al. Chimica Therapeutica, 1969 , vol. 4, p. 220 - 223 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Thiazole,2-(p-fluorobenzylideneamino)-4-phenyl |
| 2-(p-Fluorobenzylideneamino)-4-phenylthiazole |
| (4-fluoro-benzylidene)-(4-phenyl-thiazol-2-yl)-amine |