PTPN2/1-IN-2
Modify Date: 2025-09-10 18:04:24
PTPN2/1-IN-2 structure
|
Common Name | PTPN2/1-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2407611-02-1 | Molecular Weight | 398.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19FN2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PTPN2/1-IN-2PTPN2/1-IN-2 is a PTPN2/1 antagonist that can be used in various tumor research[1]. |
| Name | PTPN2/1-IN-2 |
|---|
| Description | PTPN2/1-IN-2 is a PTPN2/1 antagonist that can be used in various tumor research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H19FN2O6S |
|---|---|
| Molecular Weight | 398.41 |
| InChIKey | KJYRSQLWJMEJNM-UHFFFAOYSA-N |
| SMILES | CC(C)(O)CCOc1ccc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2c1 |