ethyl 4-hydroxy-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate structure
|
Common Name | ethyl 4-hydroxy-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 240800-53-7 | Molecular Weight | 317.28400 | |
| Density | 1.417g/cm3 | Boiling Point | 395.3ºC at 760mmHg | |
| Molecular Formula | C13H10F3NO3S | Melting Point | 114-115ºC | |
| MSDS | N/A | Flash Point | 192.9ºC | |
| Name | ethyl 4-hydroxy-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 395.3ºC at 760mmHg |
| Melting Point | 114-115ºC |
| Molecular Formula | C13H10F3NO3S |
| Molecular Weight | 317.28400 |
| Flash Point | 192.9ºC |
| Exact Mass | 317.03300 |
| PSA | 87.66000 |
| LogP | 3.71120 |
| Vapour Pressure | 8.17E-07mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | WRONBITZBMSSSZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(-c2cccc(C(F)(F)F)c2)nc1O |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| ETHYL 4-HYDROXY-2-[3-(TRIFLUOROMETHYL)PHENYL]THIAZOLE-5-CARBOXYLATE |
| 5-(Ethoxycarbonyl)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole,3-[5-(Ethoxycarbonyl)-4-hydroxy-1,3-thiazol-2-yl]benzotrifluoride |