Fmoc-L-Lys(N3-Aca-DIM)-OH structure
|
Common Name | Fmoc-L-Lys(N3-Aca-DIM)-OH | ||
|---|---|---|---|---|
| CAS Number | 2408993-39-3 | Molecular Weight | 629.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H43N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-L-Lys(N3-Aca-DIM)-OHFmoc-L-Lys(N3-Aca-DIM)-OH is a click chemistry reagent containing an azide group. Used as a SPPS building-block for the “helping hand” strategy for purification of highly insoluble peptides. Solubilizing residues are attached to the Lys side-chains using Click-chemistry. The solubilizing tag can be removed with 1M hydrazine or hydroxylamine solution[1]. |
| Name | Fmoc-L-Lys(N3-Aca-DIM)-OH |
|---|
| Description | Fmoc-L-Lys(N3-Aca-DIM)-OH is a click chemistry reagent containing an azide group. Used as a SPPS building-block for the “helping hand” strategy for purification of highly insoluble peptides. Solubilizing residues are attached to the Lys side-chains using Click-chemistry. The solubilizing tag can be removed with 1M hydrazine or hydroxylamine solution[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C35H43N5O6 |
|---|---|
| Molecular Weight | 629.75 |
| InChIKey | BFEOBKQXWBSIEV-LJAQVGFWSA-N |
| SMILES | CC1(C)CC(=O)C(C(CCCCCN=[N+]=[N-])=NCCCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)=C(O)C1 |