4(3H)-Quinazolinone,6-nitro-2-[2-(4-nitrophenyl)ethenyl]- structure
|
Common Name | 4(3H)-Quinazolinone,6-nitro-2-[2-(4-nitrophenyl)ethenyl]- | ||
|---|---|---|---|---|
| CAS Number | 24093-15-0 | Molecular Weight | 338.27400 | |
| Density | 1.52g/cm3 | Boiling Point | 556.7ºC at 760 mmHg | |
| Molecular Formula | C16H10N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.5ºC | |
| Name | 6-nitro-2-[(E)-2-(4-nitrophenyl)ethenyl]-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 556.7ºC at 760 mmHg |
| Molecular Formula | C16H10N4O5 |
| Molecular Weight | 338.27400 |
| Flash Point | 290.5ºC |
| Exact Mass | 338.06500 |
| PSA | 137.39000 |
| LogP | 3.95630 |
| Vapour Pressure | 1.97E-12mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | UMASYSCVENODRV-FPYGCLRLSA-N |
| SMILES | O=c1[nH]c(C=Cc2ccc([N+](=O)[O-])cc2)nc2ccc([N+](=O)[O-])cc12 |
|
~%
4(3H)-Quinazoli... CAS#:24093-15-0 |
| Literature: Bogert; Beal Journal of the American Chemical Society, 1912 , vol. 34, p. 522 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-Nitro-2-(4-nitro-styryl)-3H-chinazolin-4-on |
| 6-nitro-2-(4-nitro-styryl)-3H-quinazolin-4-one |
| 2-(p-Nitrostyrol)-6-nitro-(4)-chinazolon |