(8β)-6-Methylergoline-8-carboxamide structure
|
Common Name | (8β)-6-Methylergoline-8-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2410-19-7 | Molecular Weight | 269.34200 | |
| Density | 1.3g/cm3 | Boiling Point | 539.9ºC at 760 mmHg | |
| Molecular Formula | C16H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.3ºC | |
| Name | (8β)-6-Methylergoline-8-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 539.9ºC at 760 mmHg |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.34200 |
| Flash Point | 280.3ºC |
| Exact Mass | 269.15300 |
| PSA | 63.11000 |
| LogP | 2.70080 |
| Vapour Pressure | 1E-11mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | OEVHDXFBOKGRLN-MPKXVKKWSA-N |
| SMILES | CN1CC(C(N)=O)CC2c3cccc4[nH]cc(c34)CC21 |
|
~%
(8β)-6-Methyler... CAS#:2410-19-7 |
| Literature: Misner; Garbrecht; Marzoni; Whitten; Cohen Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 652 - 656 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-methyl-ergoline-8-carboxylic acid butylamide |
| n-butyl-6-methylergoline-8-carboxamide |
| 6-methyl-ergoline-8-carboxylic acid amide |