ZW290 structure
|
Common Name | ZW290 | ||
|---|---|---|---|---|
| CAS Number | 2411852-67-8 | Molecular Weight | 414.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ZW290ZW290 is a compound to activate brown adipose tissue (BAT) thermogenic function. ZW290 increases the expression of uncoupling Protein 1 (UCP1) protein and inhibits ATP synthesis in BAT[1]. |
| Name | ZW290 |
|---|
| Description | ZW290 is a compound to activate brown adipose tissue (BAT) thermogenic function. ZW290 increases the expression of uncoupling Protein 1 (UCP1) protein and inhibits ATP synthesis in BAT[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H18N2O6S |
|---|---|
| Molecular Weight | 414.43 |
| InChIKey | UTZGOZCCSVFUFE-DHDCSXOGSA-N |
| SMILES | COc1ccc(N2C(=O)C(=Cc3ccc(OCC(=O)O)c(OC)c3)NC2=S)cc1 |