HBV-IN-15 structure
|
Common Name | HBV-IN-15 | ||
|---|---|---|---|---|
| CAS Number | 2413192-50-2 | Molecular Weight | 442.89 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H23ClO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HBV-IN-15HBV-IN-15 is a potent inhibitor of covalently closed circular DNA (cccDNA). cccDNA serves as the template for viral RNA transcription and subsequent viral DNA generation. HBV-IN-15 is a flavone derivative. HBV-IN-16 has the potential for the research of HBV infection (extracted from patent WO2020052774A1, compound 2)[1]. |
| Name | HBV-IN-15 |
|---|
| Description | HBV-IN-15 is a potent inhibitor of covalently closed circular DNA (cccDNA). cccDNA serves as the template for viral RNA transcription and subsequent viral DNA generation. HBV-IN-15 is a flavone derivative. HBV-IN-16 has the potential for the research of HBV infection (extracted from patent WO2020052774A1, compound 2)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H23ClO6 |
|---|---|
| Molecular Weight | 442.89 |
| InChIKey | PMPRIBLBKGUZRA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(OCCOc2ccc(-c3cc(=O)c4cccc(Cl)c4o3)cc2)C1 |