10-nitro-11b-phenyl-2,3,5,7-tetrahydro-[1,3]oxazolo[3,2-d][1,4]benzodiazepin-6-one structure
|
Common Name | 10-nitro-11b-phenyl-2,3,5,7-tetrahydro-[1,3]oxazolo[3,2-d][1,4]benzodiazepin-6-one | ||
|---|---|---|---|---|
| CAS Number | 24143-26-8 | Molecular Weight | 325.31900 | |
| Density | 1.45g/cm3 | Boiling Point | 535.6ºC at 760mmHg | |
| Molecular Formula | C17H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.7ºC | |
| Name | 10-nitro-11b-phenyl-2,3,5,7-tetrahydro-[1,3]oxazolo[3,2-d][1,4]benzodiazepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 535.6ºC at 760mmHg |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.31900 |
| Flash Point | 277.7ºC |
| Exact Mass | 325.10600 |
| PSA | 90.88000 |
| LogP | 2.62640 |
| Vapour Pressure | 1.51E-11mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | KGGOWQMSGRLLMV-UHFFFAOYSA-N |
| SMILES | O=C1CN2CCOC2(c2ccccc2)c2cc([N+](=O)[O-])ccc2N1 |
|
~%
10-nitro-11b-ph... CAS#:24143-26-8 |
| Literature: Miyadera; Terada; Fukunaga; Kawano; Kamioka; Tamura; Takagi; Tachikawa Journal of medicinal chemistry, 1971 , vol. 14, # 6 p. 520 - 526 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Oxazolo(3,2-d)(1,4)benzodiazepin-6(5H)-one,2,3,7,11b-tetrahydro-10-nitro-11b-phenyl |
| 10-nitro-11b-phenyl-2,3,7,11b-tetrahydro[1,3]oxazolo[3,2-d][1,4]benzodiazepin-6(5h)-one |
| 10-nitro-11b-phenyl-2,3,7,11b-tetrahydro-benzo[f]oxazolo[3,2-d][1,4]diazepin-6-one |
| 2,3,7,11b-Tetrahydro-10-nitro-11b-phenyloxazolo(3,2-d)(1,4)benzodiazepin-6(5H)-one |