5-Nitro-2-(bromoacetamido)benzophenone structure
|
Common Name | 5-Nitro-2-(bromoacetamido)benzophenone | ||
|---|---|---|---|---|
| CAS Number | 2011-70-3 | Molecular Weight | 363.16300 | |
| Density | 1.609g/cm3 | Boiling Point | 590.3ºC at 760mmHg | |
| Molecular Formula | C15H11BrN2O4 | Melting Point | 156-158ºC | |
| MSDS | N/A | Flash Point | 310.8ºC | |
| Name | N-(2-benzoyl-4-nitrophenyl)-2-bromoacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.609g/cm3 |
|---|---|
| Boiling Point | 590.3ºC at 760mmHg |
| Melting Point | 156-158ºC |
| Molecular Formula | C15H11BrN2O4 |
| Molecular Weight | 363.16300 |
| Flash Point | 310.8ºC |
| Exact Mass | 361.99000 |
| PSA | 91.99000 |
| LogP | 3.75540 |
| Vapour Pressure | 6.55E-14mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | USZJZGVAIGKLRF-UHFFFAOYSA-N |
| SMILES | O=C(CBr)Nc1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Nitro-2-bromacetylamino-benzophenon |
| 2-(2-bromo-acetylamino)-5-nitro-benzophenone |
| 5-NITRO-2-(BROMOACETAMIDO)BENZOPHENONE |
| 2-Bromacetamido-5-nitrobenzophenon |
| EINECS 217-932-0 |
| 2-(bromoacetamido)-5-nitrobenzophenone |
| 2-Bromacetamino-5-nitro-benzophenon |
| 2-Bromacetylamino-5-nitrobenzophenon |
| 2'-Benzoyl-2-bromo-4'-nitroacetanilide |