EMI56 structure
|
Common Name | EMI56 | ||
|---|---|---|---|---|
| CAS Number | 2414374-41-5 | Molecular Weight | 348.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EMI56EMI56, the derivative of EMI1, displays greater potency toward mutant EGFR than EMI1. EMI56 inhibits EGFR triple mutants[1]. |
| Name | EMI56 |
|---|
| Description | EMI56, the derivative of EMI1, displays greater potency toward mutant EGFR than EMI1. EMI56 inhibits EGFR triple mutants[1]. |
|---|---|
| Related Catalog | |
| Target |
EGFRL858R/T790M/C797S EGFRdel19 T790M C797S |
| In Vitro | EMI56 inhibits EGFR ex19del/T790M/C797S and EGFR L858R/T790M/C797S. EMI56 can be used in the research of mutant EGFR-associated, drug-resistant non-small-cell lung cancer (NSCLC)[1]. |
| References |
| Molecular Formula | C21H20N2O3 |
|---|---|
| Molecular Weight | 348.40 |
| InChIKey | OYQNORRYAWXDHW-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cc2oc(=O)c(-c3nc4ccccc4o3)cc2cc1C |