Kobusone structure
|
Common Name | Kobusone | ||
|---|---|---|---|---|
| CAS Number | 24173-71-5 | Molecular Weight | 222.323 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 308.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.8±16.7 °C | |
Use of KobusoneKobusoneis a natural compound isolated form Aquilaria sinensis. kobusone can stimulate islet β-cellreplication in vivo, and has the potential to be used in diabeticstudy[1][2]. |
| Name | (1R,4R,6R,10S)-4,12,12-Trimethyl-5-oxatricyclo[8.2.0.04,6]dodecan-9-one |
|---|---|
| Synonym | More Synonyms |
| Description | Kobusoneis a natural compound isolated form Aquilaria sinensis. kobusone can stimulate islet β-cellreplication in vivo, and has the potential to be used in diabeticstudy[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.0±25.0 °C at 760 mmHg |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.323 |
| Flash Point | 123.8±16.7 °C |
| Exact Mass | 222.161987 |
| PSA | 29.60000 |
| LogP | 2.21 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | UETZJEZFLKASPR-UHFFFAOYSA-N |
| SMILES | CC1(C)CC2C(=O)CCC3OC3(C)CCC21 |
| (1R,4R,6R,10S)-4,12,12-Trimethyl-5-oxatricyclo[8.2.0.0]dodecan-9-one |
| 5-Oxatricyclo[8.2.0.0]dodecan-9-one, 4,12,12-trimethyl-, (1R,4R,6R,10S)- |