17,19-Etheno-22H-benzofuro[3a,3-n][1,5,10]triazacycloeicosine-3,14,22-trione,4,5,6,7,8,9,10,11,12,13,20a,21,23,24-tetradecahydro-, (1E,15E,20aR,24aS)- structure
|
Common Name | 17,19-Etheno-22H-benzofuro[3a,3-n][1,5,10]triazacycloeicosine-3,14,22-trione,4,5,6,7,8,9,10,11,12,13,20a,21,23,24-tetradecahydro-, (1E,15E,20aR,24aS)- | ||
|---|---|---|---|---|
| CAS Number | 24185-51-1 | Molecular Weight | 437.53100 | |
| Density | 1.25g/cm3 | Boiling Point | 771.1ºC at 760 mmHg | |
| Molecular Formula | C25H31N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 420.2ºC | |
| Name | lunarine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 771.1ºC at 760 mmHg |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.53100 |
| Flash Point | 420.2ºC |
| Exact Mass | 437.23100 |
| PSA | 96.53000 |
| LogP | 3.00010 |
| Vapour Pressure | 1.06E-23mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | YIWJEBPTHXRHQF-LLMLIWGDSA-N |
| SMILES | O=C1CCC23C=CC(=O)NCCCCNCCCNC(=O)C=Cc4ccc(c2c4)OC3C1 |
17,19-Etheno-22... CAS#:24185-51-1 ~%
17,19-Etheno-22... CAS#:24185-51-1 |
| Literature: Poupat,C. et al. Tetrahedron, 1972 , vol. 28, p. 3087 - 3101 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 17,19-Etheno-22H-benzofuro[3a,3-n][1,5,10]triazacycloeicosine-3,14,22-trione, 4,5,6,7,8,9,10,11,12,13,20a,21,23,24-tetradecahydro- |
| 154Eu |
| Europium,isotope of mass 153 |