Methyl 4-acetamido-5-chloro-2-hydroxybenzoate structure
|
Common Name | Methyl 4-acetamido-5-chloro-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 24190-77-0 | Molecular Weight | 243.644 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 428.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H10ClNO4 | Melting Point | 145-146℃ | |
| MSDS | N/A | Flash Point | 212.7±28.7 °C | |
| Name | methyl 4-acetamido-5-chloro-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.2±45.0 °C at 760 mmHg |
| Melting Point | 145-146℃ |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.644 |
| Flash Point | 212.7±28.7 °C |
| Exact Mass | 243.029831 |
| PSA | 79.12000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | LNWKABRRGNSRPQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)c(NC(C)=O)cc1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~96%
Methyl 4-acetam... CAS#:24190-77-0 |
| Literature: WO2007/96352 A1, ; Page/Page column 12; 23-24 ; WO 2007/096352 A1 |
|
~%
Methyl 4-acetam... CAS#:24190-77-0 |
| Literature: US4863921 A1, ; |
|
~%
Methyl 4-acetam... CAS#:24190-77-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 6, # 22 p. 2657 - 2662 |
|
~%
Methyl 4-acetam... CAS#:24190-77-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 6, # 22 p. 2657 - 2662 |
|
~96%
Methyl 4-acetam... CAS#:24190-77-0 |
| Literature: WO2013/42135 A1, ; Page/Page column 11 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 4-acetylamino-5-chlorosalicylate |
| Methyl 4-acetamido-5-chloro-2-hydroxybenzoate |
| methyl 2-hydroxy 4-acetamino 5-chloro benzoate |
| methyl 4-acetylamino-5-chloro-2-hydroxybenzoate |
| 4-Acetylamino-5-chloro-2-hydroxybenzoicacidmethylester |
| Benzoic acid, 4-(acetylamino)-5-chloro-2-hydroxy-, methyl ester |
| 4-ACETYLAMINO-5-CHLORO-2-HYDROXYBENZOIC ACID METHYL ESTER |
| methyl 4-(acetylamino)-5-chloro-2-(2-hydroxy)benzoate |
| methyl 4-acetamido-5-chloro-salicylate |