Phenol,4,4'-[1,2-ethanediylbis(oxy)]bis- structure
|
Common Name | Phenol,4,4'-[1,2-ethanediylbis(oxy)]bis- | ||
|---|---|---|---|---|
| CAS Number | 24209-90-3 | Molecular Weight | 246.25900 | |
| Density | 1.261g/cm3 | Boiling Point | 466.6ºC at 760mmHg | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236ºC | |
| Name | 4-[2-(4-hydroxyphenoxy)ethoxy]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 466.6ºC at 760mmHg |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.25900 |
| Flash Point | 236ºC |
| Exact Mass | 246.08900 |
| PSA | 58.92000 |
| LogP | 2.55560 |
| Vapour Pressure | 2.5E-09mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | CLMNUWIUDGZFCN-UHFFFAOYSA-N |
| SMILES | Oc1ccc(OCCOc2ccc(O)cc2)cc1 |
| HS Code | 2909500000 |
|---|
|
~%
Phenol,4,4'-[1,... CAS#:24209-90-3 |
| Literature: Kohn; Wilhelm Monatshefte fuer Chemie, 1922 , vol. 43, p. 553 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,4'-dihydroxy-1,2-diphenoxyethane |
| Bishydrochinonaethylenaether |
| 4,4'-ethanediyldioxy-di-phenol |
| 4,4'-Aethandiyldioxy-di-phenol |