2,6-DIMETHYL-4-NITROPHENOL structure
|
Common Name | 2,6-DIMETHYL-4-NITROPHENOL | ||
|---|---|---|---|---|
| CAS Number | 2423-71-4 | Molecular Weight | 167.162 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 322.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | 168 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 145.3±13.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,6-dimethyl-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.8±30.0 °C at 760 mmHg |
| Melting Point | 168 °C (dec.)(lit.) |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Flash Point | 145.3±13.0 °C |
| Exact Mass | 167.058243 |
| PSA | 66.05000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | FNORUNUDZNWQFF-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38;R41 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | ZE8225000 |
| HS Code | 2908999090 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Different quantitation approaches for xenobiotics in human urine samples by liquid chromatography/electrospray tandem mass spectrometry.
Rapid Commun. Mass Spectrom. 16(7) , 639-45, (2002) The potential of liquid chromatography combined with tandem mass spectrometry (LC/MS/MS) for the determination of pesticide metabolites in human urine at the sub-ppb level is explored. Metabolites fro... |
|
|
Disposition requirements for binding in aqueous solution of polar substrates in the cyclohexaamylose cavity. Bergeron RJ, et al.
J. Am. Chem. Soc. 99(15) , 5146-5151, (1977)
|
| Phenol, 2,6-dimethyl-4-nitro- |
| EINECS 219-353-9 |
| MFCD00007339 |
| 2,6-DIMETHYL-4-NITROPHENOL |
| 4-Nitro-2,6-xylenol |
| 2,6-dimethyl-p-nitrophenol |
| 4-Nitro-2,6-dimethylphenol |
| 2,6-Xylenol,4-nitro |
| 2-,6-dimethyl-4-nitrophenol |
| Phenol,2,6-dimethyl-4-nitro |
| 5-Nitro-2-hydroxy-m-xylol |