1,4-bis(glycidyloxy)benzene
1,4-bis(glycidyloxy)benzene structure
|
Common Name | 1,4-bis(glycidyloxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 2425-01-6 | Molecular Weight | 222.23700 | |
| Density | 1.248g/cm3 | Boiling Point | 366.2ºC at 760mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | 110-112°C | |
| MSDS | N/A | Flash Point | 157.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 366.2ºC at 760mmHg |
| Melting Point | 110-112°C |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 157.6ºC |
| Exact Mass | 222.08900 |
| PSA | 43.52000 |
| LogP | 1.24180 |
| Vapour Pressure | 3.13E-05mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | FSYPIGPPWAJCJG-UHFFFAOYSA-N |
| SMILES | c1cc(OCC2CO2)ccc1OCC1CO1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Risk Phrases | 45 |
|---|---|
| Safety Phrases | S36/37/39-S53 |
| RIDADR | 2810 |
| HS Code | 2910900090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-bis(oxiran-2-ylmethoxy)benzene |
| 2,2'-p-phenylenedioxydimethyl-bis-oxirane |
| diglycidyl resorcinol ether |
| MFCD00186891 |
| F0777-0005 |
| 1,4-bis-oxiranylmethoxy-benzene |
| Hydroquinone diglycidyl ether |
| Hydroquinone 1,4-diglycidyl ether |
| 1,4-bis(2,3-epoxypropoxy)benzene |
| 1,4-Bis-(2,3-epoxy-propoxy)-benzol |
| 1,4-bis(2',3'-epoxypropyloxy)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane? |
| A: Molecular formula of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is C12H14O4. |
| Q: What English synonyms does 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane have? |
| A: English synonyms of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane: 1,4-bis(oxiran-2-ylmethoxy)benzene, 2,2'-p-phenylenedioxydimethyl-bis-oxirane, diglycidyl resorcinol ether, MFCD00186891, F0777-0005, 1,4-bis-oxiranylmethoxy-benzene, Hydroquinone diglycidyl ether, Hydroquinone 1,4-diglycidyl ether, 1,4-bis(2,3-epoxypropoxy)benzene, 1,4-Bis-(2,3-epoxy-propoxy)-benzol, 1,4-bis(2',3'-epoxypropyloxy)benzene. |
| Q: What is the English name of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane? |
| A: The English name of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane. |
| Q: What is the SMILES notation of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane? |
| A: SMILES notation of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is c1cc(OCC2CO2)ccc1OCC1CO1. |
| Q: What is the molecular weight of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane? |
| A: Molecular weight of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is 222.23700. |
| Q: What is the InChIKey of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane? |
| A: InChIKey of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is FSYPIGPPWAJCJG-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane? |
| A: LogP of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is 1.24180. |
| Q: What is the melting point of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane? |
| A: Melting point of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is 110-112°C. |
| Q: What is the CAS number of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane? |
| A: CAS number of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is 2425-01-6. |
| Q: What is the boiling point of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane? |
| A: Boiling point of 2-[[4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane is 366.2ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |