Captafol structure
|
Common Name | Captafol | ||
|---|---|---|---|---|
| CAS Number | 2425-06-1 | Molecular Weight | 349.061 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 365.7±52.0 °C at 760 mmHg | |
| Molecular Formula | C10H9Cl4NO2S | Melting Point | 160-161° | |
| MSDS | Chinese USA | Flash Point | 175.0±30.7 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | captafol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.7±52.0 °C at 760 mmHg |
| Melting Point | 160-161° |
| Molecular Formula | C10H9Cl4NO2S |
| Molecular Weight | 349.061 |
| Flash Point | 175.0±30.7 °C |
| Exact Mass | 346.910797 |
| PSA | 62.68000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | JHRWWRDRBPCWTF-UHFFFAOYSA-N |
| SMILES | O=C1C2CC=CCC2C(=O)N1SC(Cl)(Cl)C(Cl)Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H350-H410 |
| Precautionary Statements | P201-P273-P280-P308 + P313-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Phrases | 45-43-50/53 |
| Safety Phrases | S45;S53;S60;S61 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | GW4900000 |
|
DNA damage and micronuclei induced in rat and human kidney cells by six chemicals carcinogenic to the rat kidney.
Toxicology 204(2-3) , 187-95, (2004) Six chemicals, known to induce kidney tumors in rats, were examined for their ability to induce DNA fragmentation and formation of micronuclei in primary cultures of rat and human kidney cells, and in... |
|
|
Captafol.
Rep. Carcinog. 12 , 83-6, (2011)
|
|
|
[Determination of captafol, cyhexatin, 1-naphthylacetic acid and quintozene in apple, Japanese pear and melon by simultaneous extraction].
Shokuhin Eiseigaku Zasshi 44(2) , 126-31, (2003) A simple and rapid method is described for the determination of the non-registered pesticides, captafol, quintozene (PCNB), cyhexatin and 1-naphthylacetic acid (NAA), in fruits. These pesticides were ... |
| 3a,4,7,7a-tetrahydro-N-(1,1,2,2-tetrachloroethanesulfenyl)phthalimide |
| FOLTAF |
| Captatol |
| 2-(1,1,2,2-tetrachloro-ethylsulfanyl)-3a,4,7,7a-tetrahydro-isoindole-1,3-dione |
| haipen |
| EINECS 219-363-3 |
| N-(1,1,2,2-tetrachloroethylthio)-1,2,3,6-tetrahydrophthalimide |
| N-(1,1,2,2-tetrachloroethylthio)cyclohex-4-ene-1,2-dicarboximide |
| Sanspor |
| cs5623 |
| 2-[(1,1,2,2-Tetrachloroethyl)sulfanyl]-3a,4,7,7a-tetrahydro-1H-isoindole-1,3(2H)-dione |
| Difosan |
| 3a,4,7,7a-tetrahydro-2-[(1,1,2,2-tetrachloroethyl)thio]-1H-isoindole-1,3(2H)-dione |
| Captofol |
| MFCD00041816 |
| Folcid |
| 3a,4,7,7a-Tetrahydro-2-((1,1,2,2-tetrachloroethyl)thio)-1H-isoindole-1,3(2H)-dione (9CI) |
| Captafol |
| kenofol |