2-bromo-1,2-diphenylethanol
2-bromo-1,2-diphenylethanol structure
|
Common Name | 2-bromo-1,2-diphenylethanol | ||
|---|---|---|---|---|
| CAS Number | 2425-29-8 | Molecular Weight | 277.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-bromo-1,2-diphenylethanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13BrO |
|---|---|
| Molecular Weight | 277.15600 |
| Exact Mass | 276.01500 |
| PSA | 20.23000 |
| LogP | 3.85620 |
| InChIKey | NYLNWCSXNPCEJP-UHFFFAOYSA-N |
| SMILES | OC(c1ccccc1)C(Br)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
2-bromo-1,2-dip... CAS#:2425-29-8 |
| Literature: Chen, Guohong; Wang, Xin; Jin, Xiaoqian; Liu, Lingyan; Chang, Weixing; Li, Jing Science China Chemistry, 2010 , vol. 53, # 6 p. 1294 - 1301 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 5 | |
CAS#:451-40-1
CAS#:947-91-1
CAS#:13921-79-4
CAS#:19456-17-8
CAS#:1439-07-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Brom-1,2-diphenyl-aethanol |
| bromohydrine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-bromo-1,2-diphenylethanol? |
| A: CAS number of 2-bromo-1,2-diphenylethanol is 2425-29-8. |
| Q: What is the molecular weight of 2-bromo-1,2-diphenylethanol? |
| A: Molecular weight of 2-bromo-1,2-diphenylethanol is 277.15600. |
| Q: What is the English name of 2-bromo-1,2-diphenylethanol? |
| A: The English name of 2-bromo-1,2-diphenylethanol is 2-bromo-1,2-diphenylethanol. |
| Q: What is the SMILES notation of 2-bromo-1,2-diphenylethanol? |
| A: SMILES notation of 2-bromo-1,2-diphenylethanol is OC(c1ccccc1)C(Br)c1ccccc1. |
| Q: What is the polar surface area (PSA) of 2-bromo-1,2-diphenylethanol? |
| A: Polar surface area (PSA) of 2-bromo-1,2-diphenylethanol is 20.23000. |
| Q: What English synonyms does 2-bromo-1,2-diphenylethanol have? |
| A: English synonyms of 2-bromo-1,2-diphenylethanol: 2-Brom-1,2-diphenyl-aethanol, bromohydrine. |
| Q: What is the molecular formula of 2-bromo-1,2-diphenylethanol? |
| A: Molecular formula of 2-bromo-1,2-diphenylethanol is C14H13BrO. |
| Q: What are the downstream products of 2-bromo-1,2-diphenylethanol? |
| A: Related downstream products(CAS) of 2-bromo-1,2-diphenylethanol: 451-40-1;947-91-1;13921-79-4;19456-17-8;1439-07-2. |
| Q: What is the Chinese name of 2425-29-8? |
| A: Chinese name of 2425-29-8 is 2425-29-8. |
| Q: What is the InChIKey of 2-bromo-1,2-diphenylethanol? |
| A: InChIKey of 2-bromo-1,2-diphenylethanol is NYLNWCSXNPCEJP-UHFFFAOYSA-N. |