Benzaldehyde,3-methoxy-2-[(phenylsulfonyl)oxy]- structure
|
Common Name | Benzaldehyde,3-methoxy-2-[(phenylsulfonyl)oxy]- | ||
|---|---|---|---|---|
| CAS Number | 2426-85-9 | Molecular Weight | 292.30700 | |
| Density | 1.336g/cm3 | Boiling Point | 486.6ºC at 760mmHg | |
| Molecular Formula | C14H12O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.1ºC | |
| Name | 2-Formyl-6-methoxy-3-nitrophenyl benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 486.6ºC at 760mmHg |
| Molecular Formula | C14H12O5S |
| Molecular Weight | 292.30700 |
| Flash Point | 248.1ºC |
| Exact Mass | 292.04100 |
| PSA | 78.05000 |
| LogP | 3.35620 |
| Vapour Pressure | 1.27E-09mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | PYRREPLERCADBI-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=O)c1OS(=O)(=O)c1ccccc1 |
| HS Code | 2912499000 |
|---|
|
~%
Benzaldehyde,3-... CAS#:2426-85-9 |
| Literature: Ortho Pharmaceutical Corporation Patent: US4672116 A1, 1987 ; |
|
~90%
Benzaldehyde,3-... CAS#:2426-85-9 |
| Literature: Press; Bandurco; Wong; et al. Journal of Heterocyclic Chemistry, 1986 , vol. 23, # 6 p. 1821 - 1828 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-benzenesulfonyloxy-3-methoxy-6-nitro-benzaldehyde |
| 2-Benzenesulfonyloxy-3-methoxybenzaldehyde |
| 2-Benzolsulfonyloxy-3-methoxy-6-nitro-benzaldehyd |
| 2-Benzolsulfonyloxy-3-methoxy-benzaldehyd |
| 2-Hydroxy-3-methoxybenzaldehyde benzenesulfonate |
| Benzolsulfonsaeure-<2-formyl-6-methoxy-phenylester> |
| 2-Hydroxy-3-methoxy-6-nitrobenzaldehyde benzenesulfonate |