3,6-Dichloro-2,4-dinitrophenyl methacrylate structure
|
Common Name | 3,6-Dichloro-2,4-dinitrophenyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 24291-69-8 | Molecular Weight | 321.07000 | |
| Density | 1.585g/cm3 | Boiling Point | 441.3ºC at 760mmHg | |
| Molecular Formula | C10H6Cl2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.7ºC | |
| Name | (3,6-dichloro-2,4-dinitrophenyl) 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585g/cm3 |
|---|---|
| Boiling Point | 441.3ºC at 760mmHg |
| Molecular Formula | C10H6Cl2N2O6 |
| Molecular Weight | 321.07000 |
| Flash Point | 220.7ºC |
| Exact Mass | 319.96000 |
| PSA | 117.94000 |
| LogP | 4.33770 |
| Vapour Pressure | 5.5E-08mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | OXQBCZMXEKVZOL-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1c(Cl)cc([N+](=O)[O-])c(Cl)c1[N+](=O)[O-] |
| HS Code | 2916140000 |
|---|
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| Methacrylic acid,3,6-dichloro-2,4-dinitrophenyl ester |
| 3,6-Dichloro-2,4-dinitrophenyl methacrylate |
| 3,6-dichloro-2,4-dinitrophenyl 2-methylprop-2-enoate |
| 2-Propenoic acid,2-methyl-,3,6-dichloro-2,4-dinitrophenyl ester |