Benzamide,2,4-dichloro-N,N-diethyl- structure
|
Common Name | Benzamide,2,4-dichloro-N,N-diethyl- | ||
|---|---|---|---|---|
| CAS Number | 24309-78-2 | Molecular Weight | 246.13300 | |
| Density | 1.22g/cm3 | Boiling Point | 370.3ºC at 760mmHg | |
| Molecular Formula | C11H13Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.8ºC | |
| Name | 2,4-dichloro-N,N-diethylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 370.3ºC at 760mmHg |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.13300 |
| Flash Point | 177.8ºC |
| Exact Mass | 245.03700 |
| PSA | 20.31000 |
| LogP | 3.47540 |
| Vapour Pressure | 1.12E-05mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | GGOKDRJJUVBGNT-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)c1ccc(Cl)cc1Cl |
|
~98%
Benzamide,2,4-d... CAS#:24309-78-2 |
| Literature: Yates, Matthew H.; Kallman, Neil J.; Ley, Christopher P.; Wei, Jeffrey N. Organic Process Research and Development, 2009 , vol. 13, # 2 p. 255 - 262 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-Dichlor-benzoesaeure-diaethylamid |
| 2,4-dichloro-benzoic acid diethylamide |