1-(Toluene-4-sulfonyl)-1,2,3,4-tetrahydrobenzo[b]azepin-5-one structure
|
Common Name | 1-(Toluene-4-sulfonyl)-1,2,3,4-tetrahydrobenzo[b]azepin-5-one | ||
|---|---|---|---|---|
| CAS Number | 24310-36-9 | Molecular Weight | 315.38700 | |
| Density | 1.286 g/cm3 | Boiling Point | 489.7ºC at 760 mmHg | |
| Molecular Formula | C17H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.9ºC | |
| Name | 1-[(4-Methylphenyl)sulfonyl]-1,2,3,4-tetrahydro-5H-1-benzazepin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286 g/cm3 |
|---|---|
| Boiling Point | 489.7ºC at 760 mmHg |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.38700 |
| Flash Point | 249.9ºC |
| Exact Mass | 315.09300 |
| PSA | 62.83000 |
| LogP | 4.31260 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | OTPIOAHUBNERHE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(=O)c3ccccc32)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(TOLUENE-4-SULFONYL)-1,2,3,4-TETRAHYDRO-BENZO(B)AZEPIN-5-ONE |
| 1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-1-benzazepin-5-one |