2-Methyl-1,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine structure
|
Common Name | 2-Methyl-1,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine | ||
|---|---|---|---|---|
| CAS Number | 318237-73-9 | Molecular Weight | 199.252 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 529.2±19.0 °C at 760 mmHg | |
| Molecular Formula | C12H13N3 | Melting Point | 178-180ºC | |
| MSDS | N/A | Flash Point | 273.8±21.5 °C | |
| Name | 2-methyl-3,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.2±19.0 °C at 760 mmHg |
| Melting Point | 178-180ºC |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.252 |
| Flash Point | 273.8±21.5 °C |
| Exact Mass | 199.110947 |
| PSA | 40.71000 |
| LogP | 1.12 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | QUNIZYMESYDMBI-UHFFFAOYSA-N |
| SMILES | Cc1nc2c([nH]1)CCNc1ccccc1-2 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-1,4,5,6-tetrahydroimidazo[4,5-d][1]benzazepine |
| Imidazo[4,5-d][1]benzazepine, 1,4,5,6-tetrahydro-2-methyl- |