2,4-Dimethyl-3,5-dicarbethoxypyrrole
2,4-Dimethyl-3,5-dicarbethoxypyrrole structure
|
Common Name | 2,4-Dimethyl-3,5-dicarbethoxypyrrole | ||
|---|---|---|---|---|
| CAS Number | 2436-79-5 | Molecular Weight | 239.268 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 372.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H17NO4 | Melting Point | 135-136 °C(lit.) | |
| MSDS | N/A | Flash Point | 179.0±26.5 °C | |
Summary: Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate (CAS号：2436-79-5)，molecular formula C12H17NO4，molecular weight 239.268，is a pale yellow to pale pink solid with a melting point of 135-136°C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 372.3±37.0 °C at 760 mmHg |
| Melting Point | 135-136 °C(lit.) |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.268 |
| Flash Point | 179.0±26.5 °C |
| Exact Mass | 239.115753 |
| PSA | 68.39000 |
| LogP | 3.85 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | XSBSXJAYEPDGSF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)OCC)c1C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| WGK Germany | 3 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-dimethylpyrrole-2,4-dicarboxylic acid diethyl ester |
| Diethyl 3,5-dimethylpyrrole-2,4-dicarboxylate |
| Diethyl 2,4-Dimethyl-Pyrrol-3,5-Dicarboxylate |
| 2,4-Dimethyl-3,5-dicarbethoxypyrrole |
| 2,4-Dimethyl-3,5-diethoxycarbonyl-pyrrole |
| 3,5-Dimethyl-1H-pyrrole-2,4-dicarboxylic acid diethyl ester |
| 1H-Pyrrole-2,4-dicarboxylic acid, 3,5-dimethyl-, diethyl ester |
| Diethyl 2 ,4-dimethylpyrrole-3,5-dicarboxylate |
| Knorr's pyrrole |
| Diethyl 3,5-DiMethyl-2,4-pyrroledicarboxylate |
| Diethyl 2,4-Dimethylpyrrole-3,5-Dicarbonate |
| 3,5-Dimethyl-2,4-pyrroledicarboxylic Acid Diethyl Ester |
| Pyrrole-2,4-dicarboxylic acid, 3,5-dimethyl-, diethyl ester |
| diethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| RARECHEM AL BI 0939 |
| MFCD00005218 |
| EINECS 219-431-2 |
| 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate diethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the safety information for Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: Safety information for Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate: S24/25. |
| Q: What is the molecular weight of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: Molecular weight of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate is 239.268. |
| Q: What is the polar surface area (PSA) of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: Polar surface area (PSA) of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate is 68.39000. |
| Q: What is the CAS number of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: CAS number of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate is 2436-79-5. |
| Q: What is the boiling point of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: Boiling point of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate is 372.3±37.0 °C at 760 mmHg. |
| Q: What is the InChIKey of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: InChIKey of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate is XSBSXJAYEPDGSF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: Molecular formula of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate is C12H17NO4. |
| Q: What is the SMILES notation of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: SMILES notation of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate is CCOC(=O)c1[nH]c(C)c(C(=O)OCC)c1C. |
| Q: What is the LogP of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: LogP of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate is 3.85. |
| Q: What is the melting point of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate? |
| A: Melting point of Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate is 135-136 °C(lit.). |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |