4 4'-[(8 16-DIHYDRO-8 16-DIOXODIBENZO[A structure
|
Common Name | 4 4'-[(8 16-DIHYDRO-8 16-DIOXODIBENZO[A | ||
|---|---|---|---|---|
| CAS Number | 243670-14-6 | Molecular Weight | 586.58700 | |
| Density | 1.449g/cm3 | Boiling Point | 944.604ºC at 760 mmHg | |
| Molecular Formula | C36H26O8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 309.15ºC | |
| Name | 4,4′-[(8,16-Dihydro-8,16-dioxodibenzo[a,j]perylene-2,10-diyl)dioxy]dibutyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449g/cm3 |
|---|---|
| Boiling Point | 944.604ºC at 760 mmHg |
| Molecular Formula | C36H26O8 |
| Molecular Weight | 586.58700 |
| Flash Point | 309.15ºC |
| Exact Mass | 586.16300 |
| PSA | 127.20000 |
| LogP | 6.90300 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.73 |
| InChIKey | XZWIRUDAKQRKFW-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCOc1ccc2c(c1)c(=O)c1cccc3c1c2c1cccc2c(=O)c4cc(OCCCC(=O)O)ccc4c3c21 |
| Hazard Statements | H413 |
|---|---|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RIDADR | NONH for all modes of transport |
|
L.W. Deady et al.
Synth. Commun. 30 , 803, (2000)
|
| 2,10-Bis(3-carboxypropyloxy)dibenzo[a,j]perylene-8,16-dione |