6H-Purine-6-thione,2-amino-1,9-dihydro-9-(2-methylpropyl)- structure
|
Common Name | 6H-Purine-6-thione,2-amino-1,9-dihydro-9-(2-methylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 24397-96-4 | Molecular Weight | 223.29800 | |
| Density | 1.49g/cm3 | Boiling Point | 467.5ºC at 760mmHg | |
| Molecular Formula | C9H13N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.5ºC | |
| Name | 2-amino-9-(2-methylpropyl)-3H-purine-6-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 467.5ºC at 760mmHg |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.29800 |
| Flash Point | 236.5ºC |
| Exact Mass | 223.08900 |
| PSA | 104.61000 |
| LogP | 2.30830 |
| Vapour Pressure | 6.49E-09mmHg at 25°C |
| Index of Refraction | 1.752 |
| InChIKey | XWBIXZMDYHIGQH-UHFFFAOYSA-N |
| SMILES | CC(C)Cn1cnc2c(=S)nc(N)[nH]c21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-amino-9-isobutyl-1,9-dihydro-purine-6-thione |
| 2-Amino-9-isobutyl-6-purinethiol |
| 9-Isobutyl-2-amino-6-mercapto-9H-purin |
| 9H-Purine-6-thiol,2-amino-9-isobutyl |