4-amino-8-(trifluoromethyl)quinoline structure
|
Common Name | 4-amino-8-(trifluoromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 243977-15-3 | Molecular Weight | 212.17100 | |
| Density | 1.39g/cm3 | Boiling Point | 329.7ºC at 760mmHg | |
| Molecular Formula | C10H7F3N2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 153.2ºC | |
| Name | 8-(trifluoromethyl)quinolin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 329.7ºC at 760mmHg |
| Molecular Formula | C10H7F3N2 |
| Molecular Weight | 212.17100 |
| Flash Point | 153.2ºC |
| Exact Mass | 212.05600 |
| PSA | 38.91000 |
| LogP | 3.41700 |
| Vapour Pressure | 0.000175mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | JTMLOHYYNHRKTF-UHFFFAOYSA-N |
| SMILES | Nc1ccnc2c(C(F)(F)F)cccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 25 |
| Safety Phrases | 45 |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-trifluoromethyl-quinolin-4-ylamine |
| 8-(Trifluoromethyl)quinolin-4-amine |
| 8-(trifluoromethyl)-4-quinolinamine |
| 8-(trifluoromethyl)-4-quinolylamine |
| MFCD00269346 |
| 4-Amino-8-(trifluoromethyl)quinoline |