4-Fluoro-2-(Trifluoromethyl)CinnamicAcid structure
|
Common Name | 4-Fluoro-2-(Trifluoromethyl)CinnamicAcid | ||
|---|---|---|---|---|
| CAS Number | 243977-21-1 | Molecular Weight | 234.14700 | |
| Density | 1.438g/cm3 | Boiling Point | 268.2ºC at 760mmHg | |
| Molecular Formula | C10H6F4O2 | Melting Point | 181-183ºC | |
| MSDS | N/A | Flash Point | 116ºC | |
| Name | 4-fluoro-2-(trifluoromethyl)cinnamic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.438g/cm3 |
|---|---|
| Boiling Point | 268.2ºC at 760mmHg |
| Melting Point | 181-183ºC |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.14700 |
| Flash Point | 116ºC |
| Exact Mass | 234.03000 |
| PSA | 37.30000 |
| LogP | 2.94230 |
| Vapour Pressure | 0.00386mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | OREHSCSLACWBTF-DUXPYHPUSA-N |
| SMILES | O=C(O)C=Cc1ccc(F)cc1C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00236297 |