p-(chloromethyl)phenyltrimethoxysilane structure
|
Common Name | p-(chloromethyl)phenyltrimethoxysilane | ||
|---|---|---|---|---|
| CAS Number | 24413-04-5 | Molecular Weight | 246.763 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 279.8±15.0 °C at 760 mmHg | |
| Molecular Formula | C10H15ClO3Si | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 103.0±12.5 °C | |
| Name | 4-(chloromethyl)phenyltrimethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 279.8±15.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C10H15ClO3Si |
| Molecular Weight | 246.763 |
| Flash Point | 103.0±12.5 °C |
| Exact Mass | 246.047897 |
| PSA | 27.69000 |
| LogP | 1.66 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | ZXOFHTCCTUEJQJ-UHFFFAOYSA-N |
| SMILES | CO[Si](OC)(OC)c1ccc(CCl)cc1 |
| Water Solubility | Hydrolyzes in water. |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [4-(Chloromethyl)phenyl](trimethoxy)silane |
| Silane, [4-(chloromethyl)phenyl]trimethoxy- |
| (p-(Chloromethyl)phenyl)trimethoxysilane |
| Silane, (4-(chloromethyl)phenyl)trimethoxy- |
| p-(chloromethyl)phenyltrimethoxysilane |
| Benzene, 1-(chloromethyl)-4-(trimethoxysilyl)- |
| 4-Trimethoxysilylbenzyl chloride |