3-nitro-4-ethoxyacetophenone structure
|
Common Name | 3-nitro-4-ethoxyacetophenone | ||
|---|---|---|---|---|
| CAS Number | 24430-26-0 | Molecular Weight | 209.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-nitro-4-ethoxyacetophenone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO4 |
|---|---|
| Molecular Weight | 209.19900 |
| Exact Mass | 209.06900 |
| PSA | 72.12000 |
| LogP | 2.71930 |
| InChIKey | KUKYBOAHWULYHD-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(C)=O)cc1[N+](=O)[O-] |
| HS Code | 2914700090 |
|---|
|
~%
3-nitro-4-ethox... CAS#:24430-26-0 |
| Literature: Oelschlaeger Archiv der Pharmazie (Weinheim, Germany), 1957 , vol. 290, p. 587,595 |
|
~%
3-nitro-4-ethox... CAS#:24430-26-0 |
| Literature: Oelschlaeger,H. et al. Archiv der Pharmazie und Berichte der Deutschen Pharmazeutischen Gesellschaft, 1963 , vol. 296, p. 107 - 120 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4-Aethoxy-3-nitro-phenyl)-aethanon |
| 4'-ethoxy-3'-nitroacetophenone |
| 3-Nitro-4-aethoxy-acetophenon |
| 1-(4-ethoxy-3-nitrophenyl)ethanone |
| 3-Nitro-4-ethoxyacetophenon |