4-hydroxyphenyl benzoate structure
|
Common Name | 4-hydroxyphenyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 2444-19-1 | Molecular Weight | 214.21700 | |
| Density | 1.25g/cm3 | Boiling Point | 376.6ºC at 760mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | 164-165°C | |
| MSDS | N/A | Flash Point | 164.7ºC | |
| Name | (4-hydroxyphenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 376.6ºC at 760mmHg |
| Melting Point | 164-165°C |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.21700 |
| Flash Point | 164.7ºC |
| Exact Mass | 214.06300 |
| PSA | 46.53000 |
| LogP | 2.61140 |
| Vapour Pressure | 3.3E-06mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | JFAXJRJMFOACBO-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(O)cc1)c1ccccc1 |
| Storage condition | 2-8°C |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 4-Hydroxyphenyl benzoate |
| Hydroquinone monobenzoate |
| 4-hydroxyphenylbenzoat |
| 4-benzoyloxyphenol |
| 1,4-Diphenol,1-benzoate |
| EINECS 219-479-4 |
| BENZOIC ACID 4-HYDROXY-PHENYL ESTER |
| p-Hydroxyphenyl benzoate |
| 1,4-Benzenediol,monobenzoate |
| MFCD00053304 |