2-(4-Dimethylamino-2-hydroxy-benzoyl)-benzoic acid structure
|
Common Name | 2-(4-Dimethylamino-2-hydroxy-benzoyl)-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 24460-11-5 | Molecular Weight | 285.29500 | |
| Density | N/A | Boiling Point | 523.8ºC at 760mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.6ºC | |
| Name | 2-(4-Dimethylamino-2-hydroxy-benzoyl)-benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 523.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 270.6ºC |
| Exact Mass | 285.10000 |
| PSA | 77.84000 |
| LogP | 2.38740 |
| Vapour Pressure | 8.47E-12mmHg at 25°C |
| InChIKey | GLELQLHCSRTFFD-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)c2ccccc2C(=O)O)c(O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[4-(dimethylamino)-2-hydroxybenzoyl]benzoic acid |